C30H32N4O4 — CID 131744546
1-azabicyclo[2.2.2]octan-4-yl N-[5-[4-[(6-formyl-3-pyridinyl)amino]-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 131744546) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-4-yl N-[5-[4-[(6-formyl-3-pyridinyl)amino]-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | 1-azabicyclo[2.2.2]octan-4-yl N-[5-[4-[(6-formyl-3-pyridinyl)amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 131744546 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-4-yl N-[5-[4-[(6-formyl-3-pyridinyl)amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | O=Cc1ccc(NC(=O)CCCc2ccc(-c3ccccc3)c(NC(=O)OC34CCN(CC3)CC4)c2)cn1 |
| InChI | InChI=1S/C30H32N4O4/c35-21-25-11-10-24(20-31-25)32-28(36)8-4-5-22-9-12-26(23-6-2-1-3-7-23)27(19-22)33-29(37)38-30-13-16-34(17-14-30)18-15-30/h1-3,6-7,9-12,19-21H,4-5,8,13-18H2,(H,32,36)(H,33,37) |
| InChIKey | TVBPYXGCMZJOOF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|