C28H54O3Si2 — CID 131749898
triethyl-[3-[(2S,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]propoxy]silane (PubChem CID 131749898) has the molecular formula C28H54O3Si2 and a molecular weight of 494.91 g/mol. Its IUPAC name is triethyl-[3-[(2S,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]propoxy]silane.
| Compound Name | triethyl-[3-[(2S,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 131749898 |
| Molecular Formula | C28H54O3Si2 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | triethyl-[3-[(2S,5S)-4-methylidene-5-[(3S)-5-methyl-3-triethylsilyloxyhepta-5,6-dienyl]oxolan-2-yl]propoxy]silane |
| SMILES | C=C=C(C)C[C@H](CC[C@@H]1O[C@@H](CCCO[Si](CC)(CC)CC)CC1=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H54O3Si2/c1-10-24(8)22-27(31-33(14-5,15-6)16-7)19-20-28-25(9)23-26(30-28)18-17-21-29-32(11-2,12-3)13-4/h26-28H,1,9,11-23H2,2-8H3/t26-,27-,28-/m0/s1 |
| InChIKey | QEUVJFJRXDXHST-KCHLEUMXSA-N |
| XLogP | 8.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|