C41H47FO5Si — CID 131843859
(4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[2-[3-(4-fluorophenoxy)propyl]-4-methyl-6-prop-2-enylphenoxy]methyl]oxan-2-one (PubChem CID 131843859) has the molecular formula C41H47FO5Si and a molecular weight of 666.91 g/mol. Its IUPAC name is (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[2-[3-(4-fluorophenoxy)propyl]-4-methyl-6-prop-2-enylphenoxy]methyl]oxan-2-one.
| Compound Name | (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[2-[3-(4-fluorophenoxy)propyl]-4-methyl-6-prop-2-enylphenoxy]methyl]oxan-2-one |
|---|---|
| PubChem CID | 131843859 |
| Molecular Formula | C41H47FO5Si |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[2-[3-(4-fluorophenoxy)propyl]-4-methyl-6-prop-2-enylphenoxy]methyl]oxan-2-one |
| SMILES | C=CCc1cc(C)cc(CCCOc2ccc(F)cc2)c1OC[C@@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C41H47FO5Si/c1-6-14-31-25-30(2)26-32(15-13-24-44-34-22-20-33(42)21-23-34)40(31)45-29-36-27-35(28-39(43)46-36)47-48(41(3,4)5,37-16-9-7-10-17-37)38-18-11-8-12-19-38/h6-12,16-23,25-26,35-36H,1,13-15,24,27-29H2,2-5H3/t35-,36+/m1/s1 |
| InChIKey | UUZDAQRNNMMICI-XDSPJLLDSA-N |
| XLogP | 7.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|