C22H24ClFO5 — CID 15095033
(4R,6S)-6-[[4-chloro-2-[3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one (PubChem CID 15095033) has the molecular formula C22H24ClFO5 and a molecular weight of 422.88 g/mol. Its IUPAC name is (4R,6S)-6-[[4-chloro-2-[3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6S)-6-[[4-chloro-2-[3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 15095033 |
| Molecular Formula | C22H24ClFO5 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (4R,6S)-6-[[4-chloro-2-[3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one |
| SMILES | Cc1cc(Cl)cc(CCCOc2ccc(F)cc2)c1OC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C22H24ClFO5/c1-14-9-16(23)10-15(3-2-8-27-19-6-4-17(24)5-7-19)22(14)28-13-20-11-18(25)12-21(26)29-20/h4-7,9-10,18,20,25H,2-3,8,11-13H2,1H3/t18-,20+/m1/s1 |
| InChIKey | WONQEYZVAUFFQT-QUCCMNQESA-N |
| XLogP | 4.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|