C29H30F2O4 — CID 70349602
(4R,6S)-6-[[2-[bis(3-fluoro-4-methylphenyl)methyl]-4,6-dimethylphenoxy]methyl]-4-hydroxyoxan-2-one (PubChem CID 70349602) has the molecular formula C29H30F2O4 and a molecular weight of 480.55 g/mol. Its IUPAC name is (4R,6S)-6-[[2-[bis(3-fluoro-4-methylphenyl)methyl]-4,6-dimethylphenoxy]methyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6S)-6-[[2-[bis(3-fluoro-4-methylphenyl)methyl]-4,6-dimethylphenoxy]methyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 70349602 |
| Molecular Formula | C29H30F2O4 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (4R,6S)-6-[[2-[bis(3-fluoro-4-methylphenyl)methyl]-4,6-dimethylphenoxy]methyl]-4-hydroxyoxan-2-one |
| SMILES | Cc1cc(C)c(OC[C@@H]2C[C@@H](O)CC(=O)O2)c(C(c2ccc(C)c(F)c2)c2ccc(C)c(F)c2)c1 |
| InChI | InChI=1S/C29H30F2O4/c1-16-9-19(4)29(34-15-23-13-22(32)14-27(33)35-23)24(10-16)28(20-7-5-17(2)25(30)11-20)21-8-6-18(3)26(31)12-21/h5-12,22-23,28,32H,13-15H2,1-4H3/t22-,23+/m1/s1 |
| InChIKey | FJZQMBBDDASTML-PKTZIBPZSA-N |
| XLogP | 5.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|