C28H35FO5 — CID 70349749
6-[[2-[1-cyclohexyl-3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one (PubChem CID 70349749) has the molecular formula C28H35FO5 and a molecular weight of 470.58 g/mol. Its IUPAC name is 6-[[2-[1-cyclohexyl-3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one.
| Compound Name | 6-[[2-[1-cyclohexyl-3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 70349749 |
| Molecular Formula | C28H35FO5 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 6-[[2-[1-cyclohexyl-3-(4-fluorophenoxy)propyl]-6-methylphenoxy]methyl]-4-hydroxyoxan-2-one |
| SMILES | Cc1cccc(C(CCOc2ccc(F)cc2)C2CCCCC2)c1OCC1CC(O)CC(=O)O1 |
| InChI | InChI=1S/C28H35FO5/c1-19-6-5-9-26(28(19)33-18-24-16-22(30)17-27(31)34-24)25(20-7-3-2-4-8-20)14-15-32-23-12-10-21(29)11-13-23/h5-6,9-13,20,22,24-25,30H,2-4,7-8,14-18H2,1H3 |
| InChIKey | CYDJTJDHXYPTMH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |