C10H20O5S2 — CID 131857592
(3S,4R,5R)-1,1-bis(ethylsulfanyl)-3,4,5,6-tetrahydroxyhexan-2-one (PubChem CID 131857592) has the molecular formula C10H20O5S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (3S,4R,5R)-1,1-bis(ethylsulfanyl)-3,4,5,6-tetrahydroxyhexan-2-one.
| Compound Name | (3S,4R,5R)-1,1-bis(ethylsulfanyl)-3,4,5,6-tetrahydroxyhexan-2-one |
|---|---|
| PubChem CID | 131857592 |
| Molecular Formula | C10H20O5S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3S,4R,5R)-1,1-bis(ethylsulfanyl)-3,4,5,6-tetrahydroxyhexan-2-one |
| SMILES | CCSC(SCC)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O5S2/c1-3-16-10(17-4-2)9(15)8(14)7(13)6(12)5-11/h6-8,10-14H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | BOMVEBULNJHXHE-PRJMDXOYSA-N |
| XLogP | -0.54 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|