C6H12O5 — CID 131878572
(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-tritiohexanal (PubChem CID 131878572) has the molecular formula C6H12O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-tritiohexanal.
| Compound Name | (2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-tritiohexanal |
|---|---|
| PubChem CID | 131878572 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-tritiohexanal |
| SMILES | [3H][C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O5/c7-2-1-4(9)6(11)5(10)3-8/h2,4-6,8-11H,1,3H2/t4-,5-,6+/m1/s1/i1T/t1-,4-,5-,6+ |
| InChIKey | VRYALKFFQXWPIH-AEWDYZOQSA-N |
| XLogP | -2.35 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|