C22H25N11O5 — CID 131880141
diethyl (2S)-2-[[4-[(7-amino-3,4,5,6,8,10,11,13-octazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-12-yl)methylamino]benzoyl]amino]pentanedioate (PubChem CID 131880141) has the molecular formula C22H25N11O5 and a molecular weight of 523.51 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[(7-amino-3,4,5,6,8,10,11,13-octazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-12-yl)methylamino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[(7-amino-3,4,5,6,8,10,11,13-octazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-12-yl)methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 131880141 |
| Molecular Formula | C22H25N11O5 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | diethyl (2S)-2-[[4-[(7-amino-3,4,5,6,8,10,11,13-octazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-12-yl)methylamino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(NCc2nnc3nc(N)n4nnnc4c3n2)cc1)C(=O)OCC |
| InChI | InChI=1S/C22H25N11O5/c1-3-37-16(34)10-9-14(21(36)38-4-2)25-20(35)12-5-7-13(8-6-12)24-11-15-26-17-18(29-28-15)27-22(23)33-19(17)30-31-32-33/h5-8,14,24H,3-4,9-11H2,1-2H3,(H,25,35)(H2,23,27,29)/t14-/m0/s1 |
| InChIKey | ULGCXBXMHCYMDU-AWEZNQCLSA-N |
| XLogP | 0.06 |
| TPSA | 214.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |