C18H34O2Si2 — CID 131880925
4-[2-[diethyl(methyl)silyl]ethyl-(3-hydroxy-3-methylbut-1-ynyl)-methylsilyl]-2-methylbut-3-yn-2-ol (PubChem CID 131880925) has the molecular formula C18H34O2Si2 and a molecular weight of 338.64 g/mol. Its IUPAC name is 4-[2-[diethyl(methyl)silyl]ethyl-(3-hydroxy-3-methylbut-1-ynyl)-methylsilyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[2-[diethyl(methyl)silyl]ethyl-(3-hydroxy-3-methylbut-1-ynyl)-methylsilyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 131880925 |
| Molecular Formula | C18H34O2Si2 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-[2-[diethyl(methyl)silyl]ethyl-(3-hydroxy-3-methylbut-1-ynyl)-methylsilyl]-2-methylbut-3-yn-2-ol |
| SMILES | CC[Si](C)(CC)CC[Si](C)(C#CC(C)(C)O)C#CC(C)(C)O |
| InChI | InChI=1S/C18H34O2Si2/c1-9-21(7,10-2)15-16-22(8,13-11-17(3,4)19)14-12-18(5,6)20/h19-20H,9-10,15-16H2,1-8H3 |
| InChIKey | NDCBXZPWEOOSID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|