C25H16ClF2N5Na2O8S2 — CID 131884015
CID 131884015 (PubChem CID 131884015) has the molecular formula C25H16ClF2N5Na2O8S2 and a molecular weight of 697.99 g/mol.
| Compound Name | CID 131884015 |
|---|---|
| PubChem CID | 131884015 |
| Molecular Formula | C25H16ClF2N5Na2O8S2 |
| Molecular Weight | 697.99 g/mol |
| Exact Mass | 696.99 |
| IUPAC Name | — |
| SMILES | Cc1c(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)cc(S(=O)(=O)O)cc1Nc1nc(F)nc(F)c1Cl.[Na].[Na] |
| InChI | InChI=1S/C25H16ClF2N5O8S2.2Na/c1-9-13(6-10(42(36,37)38)7-14(9)31-24-19(26)23(27)32-25(28)33-24)30-15-8-16(43(39,40)41)20(29)18-17(15)21(34)11-4-2-3-5-12(11)22(18)35;;/h2-8,30H,29H2,1H3,(H,31,32,33)(H,36,37,38)(H,39,40,41);; |
| InChIKey | QFKMXICUQUQWSU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 218.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|