C18H29ClN2O3S — CID 131942596
N-butyl-N-[(3-chlorophenyl)methyl]-4-(methoxymethyl)piperidine-1-sulfonamide (PubChem CID 131942596) has the molecular formula C18H29ClN2O3S and a molecular weight of 388.96 g/mol. Its IUPAC name is N-butyl-N-[(3-chlorophenyl)methyl]-4-(methoxymethyl)piperidine-1-sulfonamide.
| Compound Name | N-butyl-N-[(3-chlorophenyl)methyl]-4-(methoxymethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 131942596 |
| Molecular Formula | C18H29ClN2O3S |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-butyl-N-[(3-chlorophenyl)methyl]-4-(methoxymethyl)piperidine-1-sulfonamide |
| SMILES | CCCCN(Cc1cccc(Cl)c1)S(=O)(=O)N1CCC(COC)CC1 |
| InChI | InChI=1S/C18H29ClN2O3S/c1-3-4-10-21(14-17-6-5-7-18(19)13-17)25(22,23)20-11-8-16(9-12-20)15-24-2/h5-7,13,16H,3-4,8-12,14-15H2,1-2H3 |
| InChIKey | CGFBGLCCRRXTCQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |