C20H38N10O6S — CID 131965282
(2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-thiazol-2-amine (PubChem CID 131965282) has the molecular formula C20H38N10O6S and a molecular weight of 546.66 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-thiazol-2-amine.
| Compound Name | (2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131965282 |
| Molecular Formula | C20H38N10O6S |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]hexanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid;1,3-thiazol-2-amine |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CO)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O.Nc1nccs1 |
| InChI | InChI=1S/C17H34N8O6.C3H4N2S/c18-6-2-1-4-11(25-14(28)10(19)9-26)15(29)23-8-13(27)24-12(16(30)31)5-3-7-22-17(20)21;4-3-5-1-2-6-3/h10-12,26H,1-9,18-19H2,(H,23,29)(H,24,27)(H,25,28)(H,30,31)(H4,20,21,22);1-2H,(H2,4,5)/t10-,11-,12-;/m0./s1 |
| InChIKey | RXGLQKUTYXYUQF-LFELFHSZSA-N |
| XLogP | -3.62 |
| TPSA | 300.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|