C23H16F3N3 — CID 132503424
1,5-diphenyl-5-(2,2,2-trifluoroethyl)triazolo[5,1-a]isoindole (PubChem CID 132503424) has the molecular formula C23H16F3N3 and a molecular weight of 391.40 g/mol. Its IUPAC name is 1,5-diphenyl-5-(2,2,2-trifluoroethyl)triazolo[5,1-a]isoindole.
| Compound Name | 1,5-diphenyl-5-(2,2,2-trifluoroethyl)triazolo[5,1-a]isoindole |
|---|---|
| PubChem CID | 132503424 |
| Molecular Formula | C23H16F3N3 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1,5-diphenyl-5-(2,2,2-trifluoroethyl)triazolo[5,1-a]isoindole |
| SMILES | FC(F)(F)CC1(c2ccccc2)c2ccccc2-c2c(-c3ccccc3)nnn21 |
| InChI | InChI=1S/C23H16F3N3/c24-23(25,26)15-22(17-11-5-2-6-12-17)19-14-8-7-13-18(19)21-20(27-28-29(21)22)16-9-3-1-4-10-16/h1-14H,15H2 |
| InChIKey | SDQIVQLRXOJIGP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |