C26H26N2O3 — CID 132517450
(1S,2R,3S,8S,16S,17R)-16-hydroxy-19-methyl-2-phenyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione (PubChem CID 132517450) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (1S,2R,3S,8S,16S,17R)-16-hydroxy-19-methyl-2-phenyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione.
| Compound Name | (1S,2R,3S,8S,16S,17R)-16-hydroxy-19-methyl-2-phenyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione |
|---|---|
| PubChem CID | 132517450 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (1S,2R,3S,8S,16S,17R)-16-hydroxy-19-methyl-2-phenyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione |
| SMILES | CN1C[C@H]2C(=O)[C@]3(C1)[C@@H](c1ccccc1)[C@@H]1CCCN1[C@@]31C(=O)c3ccccc3[C@@]21O |
| InChI | InChI=1S/C26H26N2O3/c1-27-14-19-23(30)24(15-27)21(16-8-3-2-4-9-16)20-12-7-13-28(20)26(24)22(29)17-10-5-6-11-18(17)25(19,26)31/h2-6,8-11,19-21,31H,7,12-15H2,1H3/t19-,20-,21-,24-,25+,26-/m0/s1 |
| InChIKey | ANSOOUQZOFMVJF-YRNRXMGWSA-N |
| XLogP | 2.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |