C26H25FN2O3 — CID 132517453
(1S,2R,3S,8S,16S,17R)-2-(4-fluorophenyl)-16-hydroxy-19-methyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione (PubChem CID 132517453) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is (1S,2R,3S,8S,16S,17R)-2-(4-fluorophenyl)-16-hydroxy-19-methyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione.
| Compound Name | (1S,2R,3S,8S,16S,17R)-2-(4-fluorophenyl)-16-hydroxy-19-methyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione |
|---|---|
| PubChem CID | 132517453 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (1S,2R,3S,8S,16S,17R)-2-(4-fluorophenyl)-16-hydroxy-19-methyl-7,19-diazahexacyclo[15.3.1.01,8.03,7.08,16.010,15]henicosa-10,12,14-triene-9,21-dione |
| SMILES | CN1C[C@H]2C(=O)[C@]3(C1)[C@@H](c1ccc(F)cc1)[C@@H]1CCCN1[C@@]31C(=O)c3ccccc3[C@@]21O |
| InChI | InChI=1S/C26H25FN2O3/c1-28-13-19-23(31)24(14-28)21(15-8-10-16(27)11-9-15)20-7-4-12-29(20)26(24)22(30)17-5-2-3-6-18(17)25(19,26)32/h2-3,5-6,8-11,19-21,32H,4,7,12-14H2,1H3/t19-,20-,21-,24-,25+,26-/m0/s1 |
| InChIKey | RPOQECYGCLJQHZ-YRNRXMGWSA-N |
| XLogP | 2.34 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |