C11H9Cl2NO3 — CID 132529895
5,6-dichloro-2-(1,4-dioxan-2-yl)-1,3-benzoxazole (PubChem CID 132529895) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is 5,6-dichloro-2-(1,4-dioxan-2-yl)-1,3-benzoxazole.
| Compound Name | 5,6-dichloro-2-(1,4-dioxan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 132529895 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 5,6-dichloro-2-(1,4-dioxan-2-yl)-1,3-benzoxazole |
| SMILES | Clc1cc2nc(C3COCCO3)oc2cc1Cl |
| InChI | InChI=1S/C11H9Cl2NO3/c12-6-3-8-9(4-7(6)13)17-11(14-8)10-5-15-1-2-16-10/h3-4,10H,1-2,5H2 |
| InChIKey | BXQJDEGBWJCPMO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |