C36H54N3OPSi2 — CID 132534278
3-[1,3-ditert-butyl-4,4-dimethyl-2-[oxosilylidene(phenyl)methyl]-1,3,2λ5,4-diazaphosphasiletidin-2-ylidene]-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine (PubChem CID 132534278) has the molecular formula C36H54N3OPSi2 and a molecular weight of 631.99 g/mol. Its IUPAC name is 3-[1,3-ditert-butyl-4,4-dimethyl-2-[oxosilylidene(phenyl)methyl]-1,3,2λ5,4-diazaphosphasiletidin-2-ylidene]-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine.
| Compound Name | 3-[1,3-ditert-butyl-4,4-dimethyl-2-[oxosilylidene(phenyl)methyl]-1,3,2λ5,4-diazaphosphasiletidin-2-ylidene]-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 132534278 |
| Molecular Formula | C36H54N3OPSi2 |
| Molecular Weight | 631.99 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | 3-[1,3-ditert-butyl-4,4-dimethyl-2-[oxosilylidene(phenyl)methyl]-1,3,2λ5,4-diazaphosphasiletidin-2-ylidene]-N-[2,6-di(propan-2-yl)phenyl]bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1/C(=P2(C(=[Si]=O)c3ccccc3)N(C(C)(C)C)[Si](C)(C)N2C(C)(C)C)C2CCC1C2 |
| InChI | InChI=1S/C36H54N3OPSi2/c1-24(2)29-19-16-20-30(25(3)4)32(29)37-31-27-21-22-28(23-27)33(31)41(34(42-40)26-17-14-13-15-18-26)38(35(5,6)7)43(11,12)39(41)36(8,9)10/h13-20,24-25,27-28H,21-23H2,1-12H3/b37-31+ |
| InChIKey | XXKNFJIWJRAKQJ-USLOJTSYSA-N |
| XLogP | 9.60 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.99 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|