C68H94Br2N2O4S2 — CID 132539956
10,13-bis(5-bromothiophen-2-yl)-1,2,7,8-tetrakis(3,7-dimethyloctoxy)phenanthro[9,10-b]quinoxaline (PubChem CID 132539956) has the molecular formula C68H94Br2N2O4S2 and a molecular weight of 1227.45 g/mol. Its IUPAC name is 10,13-bis(5-bromothiophen-2-yl)-1,2,7,8-tetrakis(3,7-dimethyloctoxy)phenanthro[9,10-b]quinoxaline.
| Compound Name | 10,13-bis(5-bromothiophen-2-yl)-1,2,7,8-tetrakis(3,7-dimethyloctoxy)phenanthro[9,10-b]quinoxaline |
|---|---|
| PubChem CID | 132539956 |
| Molecular Formula | C68H94Br2N2O4S2 |
| Molecular Weight | 1227.45 g/mol |
| Exact Mass | 1224.50 |
| IUPAC Name | 10,13-bis(5-bromothiophen-2-yl)-1,2,7,8-tetrakis(3,7-dimethyloctoxy)phenanthro[9,10-b]quinoxaline |
| SMILES | CC(C)CCCC(C)CCOc1ccc2c3ccc(OCCC(C)CCCC(C)C)c(OCCC(C)CCCC(C)C)c3c3nc4c(-c5ccc(Br)s5)ccc(-c5ccc(Br)s5)c4nc3c2c1OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C68H94Br2N2O4S2/c1-43(2)17-13-21-47(9)35-39-73-55-29-27-51-52-28-30-56(74-40-36-48(10)22-14-18-44(3)4)68(76-42-38-50(12)24-16-20-46(7)8)62(52)66-65(61(51)67(55)75-41-37-49(11)23-15-19-45(5)6)71-63-53(57-31-33-59(69)77-57)25-26-54(64(63)72-66)58-32-34-60(70)78-58/h25-34,43-50H,13-24,35-42H2,1-12H3 |
| InChIKey | OQQXUFRQZYSTSM-UHFFFAOYSA-N |
| XLogP | 23.00 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.45 |
| LogP ≤ 5 | 23.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|