C21H22NO4+ — CID 132556205
13-methyl-6,17,19-trioxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-1-ol (PubChem CID 132556205) has the molecular formula C21H22NO4+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 13-methyl-6,17,19-trioxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-1-ol.
| Compound Name | 13-methyl-6,17,19-trioxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-1-ol |
|---|---|
| PubChem CID | 132556205 |
| Molecular Formula | C21H22NO4+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 13-methyl-6,17,19-trioxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaen-1-ol |
| SMILES | C[N+]12CCc3cc4c(cc3C1(O)Cc1ccc3c(c1C2)OCO3)COC4 |
| InChI | InChI=1S/C21H22NO4/c1-22-5-4-13-6-15-10-24-11-16(15)7-18(13)21(22,23)8-14-2-3-19-20(17(14)9-22)26-12-25-19/h2-3,6-7,23H,4-5,8-12H2,1H3/q+1 |
| InChIKey | XKGKWPYZRZNYFO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|