C15H23N — CID 132558513
5-(1-adamantyl)-2-methyl-3,4-dihydro-2H-pyrrole (PubChem CID 132558513) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 5-(1-adamantyl)-2-methyl-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(1-adamantyl)-2-methyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 132558513 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 5-(1-adamantyl)-2-methyl-3,4-dihydro-2H-pyrrole |
| SMILES | CC1CCC(C23CC4CC(CC(C4)C2)C3)=N1 |
| InChI | InChI=1S/C15H23N/c1-10-2-3-14(16-10)15-7-11-4-12(8-15)6-13(5-11)9-15/h10-13H,2-9H2,1H3 |
| InChIKey | AZAODBQCUAEXNB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |