C22H30N2 — CID 15951437
(1S,8R)-5-(1-adamantyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 15951437) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (1S,8R)-5-(1-adamantyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(1-adamantyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 15951437 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | (1S,8R)-5-(1-adamantyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1nnc(C34CC5CC(CC(C5)C3)C4)cc12 |
| InChI | InChI=1S/C22H30N2/c1-20(2)17-4-5-21(20,3)19-16(17)9-18(23-24-19)22-10-13-6-14(11-22)8-15(7-13)12-22/h9,13-15,17H,4-8,10-12H2,1-3H3/t13?,14?,15?,17-,21+,22?/m0/s1 |
| InChIKey | QOFIEUXOCUYNLH-PYXMFCOJSA-N |
| XLogP | 5.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |