C26H38N4S — CID 102481368
2-methyl-1,1-bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]propane-2-thiol (PubChem CID 102481368) has the molecular formula C26H38N4S and a molecular weight of 438.69 g/mol. Its IUPAC name is 2-methyl-1,1-bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]propane-2-thiol.
| Compound Name | 2-methyl-1,1-bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]propane-2-thiol |
|---|---|
| PubChem CID | 102481368 |
| Molecular Formula | C26H38N4S |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 2-methyl-1,1-bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]propane-2-thiol |
| SMILES | CC(C)(S)C(n1cc2c(n1)[C@]1(C)CC[C@H]2C1(C)C)n1cc2c(n1)[C@]1(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C26H38N4S/c1-22(2)17-9-11-25(22,7)19-15(17)13-29(27-19)21(24(5,6)31)30-14-16-18-10-12-26(8,20(16)28-30)23(18,3)4/h13-14,17-18,21,31H,9-12H2,1-8H3/t17-,18-,25+,26+/m1/s1 |
| InChIKey | QJVAKVGBZKSLIR-AIPFARQSSA-N |
| XLogP | 6.18 |
| TPSA | 35.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|