C33H45BN6- — CID 11421627
CID 11421627 (PubChem CID 11421627) has the molecular formula C33H45BN6- and a molecular weight of 536.58 g/mol.
| Compound Name | CID 11421627 |
|---|---|
| PubChem CID | 11421627 |
| Molecular Formula | C33H45BN6- |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.38 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1nn([B-](n3cc4c(n3)[C@@]3(C)CC[C@@H]4C3(C)C)n3cc4c(n3)[C@@]3(C)CC[C@@H]4C3(C)C)cc12 |
| InChI | InChI=1S/C33H45BN6/c1-28(2)22-10-13-31(28,7)25-19(22)16-38(35-25)34(39-17-20-23-11-14-32(8,26(20)36-39)29(23,3)4)40-18-21-24-12-15-33(9,27(21)37-40)30(24,5)6/h16-18,22-24H,10-15H2,1-9H3/q-1/t22-,23-,24-,31+,32+,33+/m0/s1 |
| InChIKey | QWPIBLVPELXARI-DAIACJNJSA-N |
| XLogP | 6.73 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|