C13H16N4S — CID 10563307
(1R,11S)-1,14,14-trimethyl-3,5,6,8-tetrazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,9-triene-7-thione (PubChem CID 10563307) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is (1R,11S)-1,14,14-trimethyl-3,5,6,8-tetrazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,9-triene-7-thione.
| Compound Name | (1R,11S)-1,14,14-trimethyl-3,5,6,8-tetrazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,9-triene-7-thione |
|---|---|
| PubChem CID | 10563307 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (1R,11S)-1,14,14-trimethyl-3,5,6,8-tetrazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,9-triene-7-thione |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nc3n[nH]c(=S)n3cc12 |
| InChI | InChI=1S/C13H16N4S/c1-12(2)8-4-5-13(12,3)9-7(8)6-17-10(14-9)15-16-11(17)18/h6,8H,4-5H2,1-3H3,(H,16,18)/t8-,13+/m1/s1 |
| InChIKey | RSMCXKFJGBOBSE-OQPBUACISA-N |
| XLogP | 2.96 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|