C44H60BN8- — CID 10919688
bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]-bis[(1S,7R)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]boranuide (PubChem CID 10919688) has the molecular formula C44H60BN8- and a molecular weight of 711.83 g/mol. Its IUPAC name is bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]-bis[(1S,7R)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]boranuide.
| Compound Name | bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]-bis[(1S,7R)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]boranuide |
|---|---|
| PubChem CID | 10919688 |
| Molecular Formula | C44H60BN8- |
| Molecular Weight | 711.83 g/mol |
| Exact Mass | 711.50 |
| IUPAC Name | bis[(1R,7S)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]-bis[(1S,7R)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]boranuide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nn([B-](n3cc4c(n3)[C@]3(C)CC[C@H]4C3(C)C)(n3cc4c(n3)[C@@]3(C)CC[C@@H]4C3(C)C)n3cc4c(n3)[C@@]3(C)CC[C@@H]4C3(C)C)cc12 |
| InChI | InChI=1S/C44H60BN8/c1-37(2)29-13-17-41(37,9)33-25(29)21-50(46-33)45(51-22-26-30-14-18-42(10,34(26)47-51)38(30,3)4,52-23-27-31-15-19-43(11,35(27)48-52)39(31,5)6)53-24-28-32-16-20-44(12,36(28)49-53)40(32,7)8/h21-24,29-32H,13-20H2,1-12H3/q-1/t29-,30-,31+,32+,41+,42+,43-,44- |
| InChIKey | FNUAZDFYROKWPR-NCKPSVJGSA-N |
| XLogP | 9.10 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.83 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|