C18H26N2 — CID 69063303
(1S,8R)-5-(cyclopentylmethyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 69063303) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (1S,8R)-5-(cyclopentylmethyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1S,8R)-5-(cyclopentylmethyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 69063303 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (1S,8R)-5-(cyclopentylmethyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1nnc(CC3CCCC3)cc12 |
| InChI | InChI=1S/C18H26N2/c1-17(2)15-8-9-18(17,3)16-14(15)11-13(19-20-16)10-12-6-4-5-7-12/h11-12,15H,4-10H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | LFOGWBFQCOEDQR-MAUKXSAKSA-N |
| XLogP | 4.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |