C22H30N4 — CID 67363498
(1S,8R)-5-(1-tert-butyl-5-cyclopropylpyrazol-4-yl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 67363498) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is (1S,8R)-5-(1-tert-butyl-5-cyclopropylpyrazol-4-yl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(1-tert-butyl-5-cyclopropylpyrazol-4-yl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 67363498 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (1S,8R)-5-(1-tert-butyl-5-cyclopropylpyrazol-4-yl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC(C)(C)n1ncc(-c2cc3c(nn2)[C@@]2(C)CC[C@@H]3C2(C)C)c1C1CC1 |
| InChI | InChI=1S/C22H30N4/c1-20(2,3)26-18(13-7-8-13)15(12-23-26)17-11-14-16-9-10-22(6,21(16,4)5)19(14)25-24-17/h11-13,16H,7-10H2,1-6H3/t16-,22+/m0/s1 |
| InChIKey | AAHNUSJRWRCSQP-KSFYIVLOSA-N |
| XLogP | 5.15 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |