C28H28O3 — CID 132558693
(4S)-8,8-diphenyl-4-(2-phenylethyl)-6,10-dioxaspiro[4.5]decan-2-one (PubChem CID 132558693) has the molecular formula C28H28O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (4S)-8,8-diphenyl-4-(2-phenylethyl)-6,10-dioxaspiro[4.5]decan-2-one.
| Compound Name | (4S)-8,8-diphenyl-4-(2-phenylethyl)-6,10-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 132558693 |
| Molecular Formula | C28H28O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (4S)-8,8-diphenyl-4-(2-phenylethyl)-6,10-dioxaspiro[4.5]decan-2-one |
| SMILES | O=C1C[C@H](CCc2ccccc2)C2(C1)OCC(c1ccccc1)(c1ccccc1)CO2 |
| InChI | InChI=1S/C28H28O3/c29-26-18-25(17-16-22-10-4-1-5-11-22)28(19-26)30-20-27(21-31-28,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,25H,16-21H2/t25-/m0/s1 |
| InChIKey | GSSJVQVZMAZGCC-VWLOTQADSA-N |
| XLogP | 5.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |