C32H34N2O2 — CID 132571620
(E)-2-[3-(2,5-dimethylphenoxy)propyl]-2-methyl-5-phenyl-N-quinolin-8-ylpent-4-enamide (PubChem CID 132571620) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is (E)-2-[3-(2,5-dimethylphenoxy)propyl]-2-methyl-5-phenyl-N-quinolin-8-ylpent-4-enamide.
| Compound Name | (E)-2-[3-(2,5-dimethylphenoxy)propyl]-2-methyl-5-phenyl-N-quinolin-8-ylpent-4-enamide |
|---|---|
| PubChem CID | 132571620 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (E)-2-[3-(2,5-dimethylphenoxy)propyl]-2-methyl-5-phenyl-N-quinolin-8-ylpent-4-enamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C/C=C/c2ccccc2)C(=O)Nc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C32H34N2O2/c1-24-17-18-25(2)29(23-24)36-22-10-20-32(3,19-8-13-26-11-5-4-6-12-26)31(35)34-28-16-7-14-27-15-9-21-33-30(27)28/h4-9,11-18,21,23H,10,19-20,22H2,1-3H3,(H,34,35)/b13-8+ |
| InChIKey | HOGFBVMBJHKBAB-MDWZMJQESA-N |
| XLogP | 7.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|