C41H54O6Si — CID 132576245
ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methyl-6-(2-phenylmethoxyethyl)cyclohex-3-ene-1-carboxylate (PubChem CID 132576245) has the molecular formula C41H54O6Si and a molecular weight of 670.96 g/mol. Its IUPAC name is ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methyl-6-(2-phenylmethoxyethyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methyl-6-(2-phenylmethoxyethyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 132576245 |
| Molecular Formula | C41H54O6Si |
| Molecular Weight | 670.96 g/mol |
| Exact Mass | 670.37 |
| IUPAC Name | ethyl (1S,2R,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methyl-6-(2-phenylmethoxyethyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](CCOCc2ccccc2)[C@@H](C2COC(C)(C)OC2)C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C[C@H]1C |
| InChI | InChI=1S/C41H54O6Si/c1-8-44-39(42)37-30(2)26-36(47-48(40(3,4)5,33-20-14-10-15-21-33)34-22-16-11-17-23-34)38(32-28-45-41(6,7)46-29-32)35(37)24-25-43-27-31-18-12-9-13-19-31/h9-23,26,30,32,35,37-38H,8,24-25,27-29H2,1-7H3/t30-,35-,37+,38-/m1/s1 |
| InChIKey | RDXMTQFBORXHCA-HLELFFTASA-N |
| XLogP | 7.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.96 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|