C38H54O6Si — CID 11445061
(3R,4aS,6S,8aR)-4a-[1,3-bis(phenylmethoxy)propan-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methylspiro[1,5,6,8a-tetrahydroisochromene-3,2'-oxolane]-4-one (PubChem CID 11445061) has the molecular formula C38H54O6Si and a molecular weight of 634.93 g/mol. Its IUPAC name is (3R,4aS,6S,8aR)-4a-[1,3-bis(phenylmethoxy)propan-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methylspiro[1,5,6,8a-tetrahydroisochromene-3,2'-oxolane]-4-one.
| Compound Name | (3R,4aS,6S,8aR)-4a-[1,3-bis(phenylmethoxy)propan-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methylspiro[1,5,6,8a-tetrahydroisochromene-3,2'-oxolane]-4-one |
|---|---|
| PubChem CID | 11445061 |
| Molecular Formula | C38H54O6Si |
| Molecular Weight | 634.93 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | (3R,4aS,6S,8aR)-4a-[1,3-bis(phenylmethoxy)propan-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methylspiro[1,5,6,8a-tetrahydroisochromene-3,2'-oxolane]-4-one |
| SMILES | CC1=C[C@H]2CO[C@]3(CCCO3)C(=O)[C@@]2(C(COCc2ccccc2)COCc2ccccc2)C[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H54O6Si/c1-29-22-33-28-43-38(19-13-20-42-38)35(39)37(33,23-32(29)18-21-44-45(5,6)36(2,3)4)34(26-40-24-30-14-9-7-10-15-30)27-41-25-31-16-11-8-12-17-31/h7-12,14-17,22,32-34H,13,18-21,23-28H2,1-6H3/t32-,33+,37+,38-/m1/s1 |
| InChIKey | LRRNAVUQTAEXAJ-MUBDLGOHSA-N |
| XLogP | 8.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.93 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|