C34H50O5Si — CID 134971802
methyl (4R,5S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-4-methyl-5-(phenylmethoxymethyl)cyclohex-2-ene-1-carboxylate (PubChem CID 134971802) has the molecular formula C34H50O5Si and a molecular weight of 566.86 g/mol. Its IUPAC name is methyl (4R,5S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-4-methyl-5-(phenylmethoxymethyl)cyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (4R,5S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-4-methyl-5-(phenylmethoxymethyl)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134971802 |
| Molecular Formula | C34H50O5Si |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | methyl (4R,5S)-4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybutyl]-4-methyl-5-(phenylmethoxymethyl)cyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1C=C[C@@](C)(C(CCCOCc2ccccc2)O[Si](C)(C)C(C)(C)C)[C@@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C34H50O5Si/c1-33(2,3)40(6,7)39-31(19-14-22-37-24-27-15-10-8-11-16-27)34(4)21-20-29(32(35)36-5)23-30(34)26-38-25-28-17-12-9-13-18-28/h8-13,15-18,20-21,29-31H,14,19,22-26H2,1-7H3/t29?,30-,31?,34-/m1/s1 |
| InChIKey | AIKKFCJQXIUFKJ-WJNWMRMQSA-N |
| XLogP | 7.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|