C34H44O5Si — CID 135009927
1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone (PubChem CID 135009927) has the molecular formula C34H44O5Si and a molecular weight of 560.81 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone.
| Compound Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone |
|---|---|
| PubChem CID | 135009927 |
| Molecular Formula | C34H44O5Si |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]-2-trityloxyethanone |
| SMILES | CC1(C)O[C@H](C(=O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@](C)(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C34H44O5Si/c1-31(2,3)40(7,8)37-25-33(6)30(38-32(4,5)39-33)29(35)24-36-34(26-18-12-9-13-19-26,27-20-14-10-15-21-27)28-22-16-11-17-23-28/h9-23,30H,24-25H2,1-8H3/t30-,33+/m1/s1 |
| InChIKey | ZNAXAIKTQXYNHI-NDKRRWIDSA-N |
| XLogP | 7.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|