C38H54O6Si — CID 102331939
1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one (PubChem CID 102331939) has the molecular formula C38H54O6Si and a molecular weight of 634.93 g/mol. Its IUPAC name is 1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one.
| Compound Name | 1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one |
|---|---|
| PubChem CID | 102331939 |
| Molecular Formula | C38H54O6Si |
| Molecular Weight | 634.93 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | 1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one |
| SMILES | C=C(C(=O)[C@]1(OC/C=C/C(C)=C/CCO[Si](C)(C)C(C)(C)C)CCCO1)C(COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C38H54O6Si/c1-31(18-15-26-44-45(6,7)37(3,4)5)17-14-24-42-38(23-16-25-43-38)36(39)32(2)35(29-40-27-33-19-10-8-11-20-33)30-41-28-34-21-12-9-13-22-34/h8-14,17-22,35H,2,15-16,23-30H2,1,3-7H3/b17-14+,31-18+/t38-/m0/s1 |
| InChIKey | LDOUIIFLXLQQTG-LUKCKVIZSA-N |
| XLogP | 8.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.93 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|