C43H70O6Si2 — CID 134879194
tert-butyl-[1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butoxy]-dimethylsilane (PubChem CID 134879194) has the molecular formula C43H70O6Si2 and a molecular weight of 739.20 g/mol. Its IUPAC name is tert-butyl-[1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134879194 |
| Molecular Formula | C43H70O6Si2 |
| Molecular Weight | 739.20 g/mol |
| Exact Mass | 738.47 |
| IUPAC Name | tert-butyl-[1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butoxy]-dimethylsilane |
| SMILES | CC(/C=C/CO[C@@]1(C(CC(COCc2ccccc2)COCc2ccccc2)O[Si](C)(C)C(C)(C)C)CCCO1)=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H70O6Si2/c1-36(22-19-30-48-50(8,9)41(2,3)4)21-18-28-46-43(27-20-29-47-43)40(49-51(10,11)42(5,6)7)31-39(34-44-32-37-23-14-12-15-24-37)35-45-33-38-25-16-13-17-26-38/h12-18,21-26,39-40H,19-20,27-35H2,1-11H3/b21-18+,36-22+/t40?,43-/m0/s1 |
| InChIKey | QOSZOLADTZTPHN-RVNJYWQCSA-N |
| XLogP | 11.25 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.20 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|