C37H54O6Si — CID 134879195
1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one (PubChem CID 134879195) has the molecular formula C37H54O6Si and a molecular weight of 622.92 g/mol. Its IUPAC name is 1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one.
| Compound Name | 1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one |
|---|---|
| PubChem CID | 134879195 |
| Molecular Formula | C37H54O6Si |
| Molecular Weight | 622.92 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 1-[(2R)-2-[(2E,4E)-7-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,4-dienoxy]oxolan-2-yl]-4-phenylmethoxy-3-(phenylmethoxymethyl)butan-1-one |
| SMILES | CC(/C=C/CO[C@@]1(C(=O)CC(COCc2ccccc2)COCc2ccccc2)CCCO1)=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H54O6Si/c1-31(17-14-25-43-44(5,6)36(2,3)4)16-13-23-41-37(22-15-24-42-37)35(38)26-34(29-39-27-32-18-9-7-10-19-32)30-40-28-33-20-11-8-12-21-33/h7-13,16-21,34H,14-15,22-30H2,1-6H3/b16-13+,31-17+/t37-/m0/s1 |
| InChIKey | XIHOEPJJQIVMDR-ZEUNZOKTSA-N |
| XLogP | 8.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.92 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|