C43H58O7Si — CID 135055286
(2R,3R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-[(1S)-1-methoxy-3-phenylmethoxypropyl]-4,4,8-trimethyl-3-prop-2-enoxy-1,10-dioxaspiro[4.5]decan-7-one (PubChem CID 135055286) has the molecular formula C43H58O7Si and a molecular weight of 715.02 g/mol. Its IUPAC name is (2R,3R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-[(1S)-1-methoxy-3-phenylmethoxypropyl]-4,4,8-trimethyl-3-prop-2-enoxy-1,10-dioxaspiro[4.5]decan-7-one.
| Compound Name | (2R,3R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-[(1S)-1-methoxy-3-phenylmethoxypropyl]-4,4,8-trimethyl-3-prop-2-enoxy-1,10-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 135055286 |
| Molecular Formula | C43H58O7Si |
| Molecular Weight | 715.02 g/mol |
| Exact Mass | 714.40 |
| IUPAC Name | (2R,3R,8R,9S)-9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-[(1S)-1-methoxy-3-phenylmethoxypropyl]-4,4,8-trimethyl-3-prop-2-enoxy-1,10-dioxaspiro[4.5]decan-7-one |
| SMILES | C=CCO[C@H]1[C@@H]([C@H](CCOCc2ccccc2)OC)OC2(CC(=O)[C@H](C)[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)C1(C)C |
| InChI | InChI=1S/C43H58O7Si/c1-9-27-47-40-39(38(45-8)25-28-46-31-33-19-13-10-14-20-33)50-43(42(40,6)7)30-36(44)32(2)37(49-43)26-29-48-51(41(3,4)5,34-21-15-11-16-22-34)35-23-17-12-18-24-35/h9-24,32,37-40H,1,25-31H2,2-8H3/t32-,37-,38-,39+,40-,43?/m0/s1 |
| InChIKey | RWZJCIARYSJREC-SQMQBCEHSA-N |
| XLogP | 7.26 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.02 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|