C32H48O6Si — CID 134945795
(4aR,7aS,8R,11aS)-8-ethenyl-7a-methoxy-8-(phenylmethoxymethyl)-9-tri(propan-2-yl)silyloxy-4a,5,6,11-tetrahydro-4H-pyrano[3,4-d]chromen-1-one (PubChem CID 134945795) has the molecular formula C32H48O6Si and a molecular weight of 556.82 g/mol. Its IUPAC name is (4aR,7aS,8R,11aS)-8-ethenyl-7a-methoxy-8-(phenylmethoxymethyl)-9-tri(propan-2-yl)silyloxy-4a,5,6,11-tetrahydro-4H-pyrano[3,4-d]chromen-1-one.
| Compound Name | (4aR,7aS,8R,11aS)-8-ethenyl-7a-methoxy-8-(phenylmethoxymethyl)-9-tri(propan-2-yl)silyloxy-4a,5,6,11-tetrahydro-4H-pyrano[3,4-d]chromen-1-one |
|---|---|
| PubChem CID | 134945795 |
| Molecular Formula | C32H48O6Si |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | (4aR,7aS,8R,11aS)-8-ethenyl-7a-methoxy-8-(phenylmethoxymethyl)-9-tri(propan-2-yl)silyloxy-4a,5,6,11-tetrahydro-4H-pyrano[3,4-d]chromen-1-one |
| SMILES | C=C[C@@]1(COCc2ccccc2)C(O[Si](C(C)C)(C(C)C)C(C)C)=CC[C@@]23C(=O)COC[C@@H]2CCO[C@@]13OC |
| InChI | InChI=1S/C32H48O6Si/c1-9-30(22-36-19-26-13-11-10-12-14-26)29(38-39(23(2)3,24(4)5)25(6)7)15-17-31-27(20-35-21-28(31)33)16-18-37-32(30,31)34-8/h9-15,23-25,27H,1,16-22H2,2-8H3/t27-,30+,31-,32-/m0/s1 |
| InChIKey | LGFSGGABXSWGMA-JMYGOUQNSA-N |
| XLogP | 6.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|