C25H44O4Si — CID 132606730
2-[(2R,4R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-pentyl-1,3-dioxan-4-yl]-1-phenylethanol (PubChem CID 132606730) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is 2-[(2R,4R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-pentyl-1,3-dioxan-4-yl]-1-phenylethanol.
| Compound Name | 2-[(2R,4R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-pentyl-1,3-dioxan-4-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 132606730 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 2-[(2R,4R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-pentyl-1,3-dioxan-4-yl]-1-phenylethanol |
| SMILES | CCCCC[C@@H]1OC(CCO[Si](C)(C)C(C)(C)C)C[C@@H](CC(O)c2ccccc2)O1 |
| InChI | InChI=1S/C25H44O4Si/c1-7-8-10-15-24-28-21(16-17-27-30(5,6)25(2,3)4)18-22(29-24)19-23(26)20-13-11-9-12-14-20/h9,11-14,21-24,26H,7-8,10,15-19H2,1-6H3/t21?,22-,23?,24+/m0/s1 |
| InChIKey | BUOJVWOKRKWZKL-UEUFPXFLSA-N |
| XLogP | 6.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|