C15H12ClNO2S — CID 13270205
3-(4-chlorophenyl)-5,6-dimethoxy-1,2-benzothiazole (PubChem CID 13270205) has the molecular formula C15H12ClNO2S and a molecular weight of 305.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,6-dimethoxy-1,2-benzothiazole.
| Compound Name | 3-(4-chlorophenyl)-5,6-dimethoxy-1,2-benzothiazole |
|---|---|
| PubChem CID | 13270205 |
| Molecular Formula | C15H12ClNO2S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-(4-chlorophenyl)-5,6-dimethoxy-1,2-benzothiazole |
| SMILES | COc1cc2snc(-c3ccc(Cl)cc3)c2cc1OC |
| InChI | InChI=1S/C15H12ClNO2S/c1-18-12-7-11-14(8-13(12)19-2)20-17-15(11)9-3-5-10(16)6-4-9/h3-8H,1-2H3 |
| InChIKey | VHKKPNVXYKUXPZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |