C24H16N2O2S — CID 132820496
1-(1,3-benzodioxol-5-yl)-3-phenylsulfanylimidazo[1,5-a]quinoline (PubChem CID 132820496) has the molecular formula C24H16N2O2S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-phenylsulfanylimidazo[1,5-a]quinoline.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-phenylsulfanylimidazo[1,5-a]quinoline |
|---|---|
| PubChem CID | 132820496 |
| Molecular Formula | C24H16N2O2S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-phenylsulfanylimidazo[1,5-a]quinoline |
| SMILES | c1ccc(Sc2nc(-c3ccc4c(c3)OCO4)n3c2ccc2ccccc23)cc1 |
| InChI | InChI=1S/C24H16N2O2S/c1-2-7-18(8-3-1)29-24-20-12-10-16-6-4-5-9-19(16)26(20)23(25-24)17-11-13-21-22(14-17)28-15-27-21/h1-14H,15H2 |
| InChIKey | CZKNFQZZWHDKOP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |