C16H33BO2Si — CID 132837840
trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-en-3-yl]silane (PubChem CID 132837840) has the molecular formula C16H33BO2Si and a molecular weight of 296.34 g/mol. Its IUPAC name is trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-en-3-yl]silane.
| Compound Name | trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-en-3-yl]silane |
|---|---|
| PubChem CID | 132837840 |
| Molecular Formula | C16H33BO2Si |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | trimethyl-[(Z)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-en-3-yl]silane |
| SMILES | CCCC/C(=C/CB1OC(C)(C)C(C)(C)O1)[Si](C)(C)C |
| InChI | InChI=1S/C16H33BO2Si/c1-9-10-11-14(20(6,7)8)12-13-17-18-15(2,3)16(4,5)19-17/h12H,9-11,13H2,1-8H3/b14-12- |
| InChIKey | ONYYLYJJZKYCAO-OWBHPGMISA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|