C31H42N4 — CID 132837909
N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-5-methylimidazol-1-yl]ethanimine (PubChem CID 132837909) has the molecular formula C31H42N4 and a molecular weight of 470.71 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-5-methylimidazol-1-yl]ethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-5-methylimidazol-1-yl]ethanimine |
|---|---|
| PubChem CID | 132837909 |
| Molecular Formula | C31H42N4 |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-[4-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-5-methylimidazol-1-yl]ethanimine |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)n1cnc(/C=N/c2c(C(C)C)cccc2C(C)C)c1C |
| InChI | InChI=1S/C31H42N4/c1-19(2)25-13-11-14-26(20(3)4)30(25)32-17-29-23(9)35(18-33-29)24(10)34-31-27(21(5)6)15-12-16-28(31)22(7)8/h11-22H,1-10H3/b32-17+,34-24+ |
| InChIKey | FMRZAJZTYHEHMT-UWKHWUNSSA-N |
| XLogP | 9.03 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|