C13H22N3O6P — CID 132851032
1-[[(3S,5R)-5-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-3-yl]methyl]pyrimidine-2,4-dione (PubChem CID 132851032) has the molecular formula C13H22N3O6P and a molecular weight of 347.31 g/mol. Its IUPAC name is 1-[[(3S,5R)-5-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-3-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[(3S,5R)-5-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-3-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132851032 |
| Molecular Formula | C13H22N3O6P |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-[[(3S,5R)-5-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-3-yl]methyl]pyrimidine-2,4-dione |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@@H](Cn2ccc(=O)[nH]c2=O)N(C)O1 |
| InChI | InChI=1S/C13H22N3O6P/c1-4-20-23(19,21-5-2)12-8-10(15(3)22-12)9-16-7-6-11(17)14-13(16)18/h6-7,10,12H,4-5,8-9H2,1-3H3,(H,14,17,18)/t10-,12+/m0/s1 |
| InChIKey | NIHCVYDFOYNDCP-CMPLNLGQSA-N |
| XLogP | 0.76 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|