C15H23N6O6P — CID 56969072
1-[[1-[(3R,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione (PubChem CID 56969072) has the molecular formula C15H23N6O6P and a molecular weight of 414.36 g/mol. Its IUPAC name is 1-[[1-[(3R,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[1-[(3R,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56969072 |
| Molecular Formula | C15H23N6O6P |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[[1-[(3R,5S)-3-diethoxyphosphoryl-2-methyl-1,2-oxazolidin-5-yl]triazol-4-yl]methyl]pyrimidine-2,4-dione |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@@H](n2cc(Cn3ccc(=O)[nH]c3=O)nn2)ON1C |
| InChI | InChI=1S/C15H23N6O6P/c1-4-25-28(24,26-5-2)14-8-13(27-19(14)3)21-10-11(17-18-21)9-20-7-6-12(22)16-15(20)23/h6-7,10,13-14H,4-5,8-9H2,1-3H3,(H,16,22,23)/t13-,14+/m0/s1 |
| InChIKey | LHLJBAGZBRDYNH-UONOGXRCSA-N |
| XLogP | 0.53 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|