C29H32N2Si — CID 132918918
2-phenyl-8a-[2-tri(propan-2-yl)silylethynyl]azulene-1,1-dicarbonitrile (PubChem CID 132918918) has the molecular formula C29H32N2Si and a molecular weight of 436.68 g/mol. Its IUPAC name is 2-phenyl-8a-[2-tri(propan-2-yl)silylethynyl]azulene-1,1-dicarbonitrile.
| Compound Name | 2-phenyl-8a-[2-tri(propan-2-yl)silylethynyl]azulene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 132918918 |
| Molecular Formula | C29H32N2Si |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2-phenyl-8a-[2-tri(propan-2-yl)silylethynyl]azulene-1,1-dicarbonitrile |
| SMILES | CC(C)[Si](C#CC12C=CC=CC=C1C=C(c1ccccc1)C2(C#N)C#N)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H32N2Si/c1-22(2)32(23(3)4,24(5)6)18-17-28-16-12-8-11-15-26(28)19-27(29(28,20-30)21-31)25-13-9-7-10-14-25/h7-16,19,22-24H,1-6H3 |
| InChIKey | UOCKWGCTWVXLSB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|