C16H17N3O2 — CID 132968914
2,4-dimethoxy-9-phenyl-5,8-dihydropyrimido[4,5-b]azepine (PubChem CID 132968914) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,4-dimethoxy-9-phenyl-5,8-dihydropyrimido[4,5-b]azepine.
| Compound Name | 2,4-dimethoxy-9-phenyl-5,8-dihydropyrimido[4,5-b]azepine |
|---|---|
| PubChem CID | 132968914 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2,4-dimethoxy-9-phenyl-5,8-dihydropyrimido[4,5-b]azepine |
| SMILES | COc1nc(OC)c2c(n1)N(c1ccccc1)CC=CC2 |
| InChI | InChI=1S/C16H17N3O2/c1-20-15-13-10-6-7-11-19(12-8-4-3-5-9-12)14(13)17-16(18-15)21-2/h3-9H,10-11H2,1-2H3 |
| InChIKey | JUGCKQGZVKGHDK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|