C18H23N5O6 — CID 133065324
N-[[(3aR,4R,7R,7aS)-7-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-1-methylimidazole-4-carboxamide (PubChem CID 133065324) has the molecular formula C18H23N5O6 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[[(3aR,4R,7R,7aS)-7-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[[(3aR,4R,7R,7aS)-7-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 133065324 |
| Molecular Formula | C18H23N5O6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[[(3aR,4R,7R,7aS)-7-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-1-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C(=O)NC[C@H]2OC[C@@H](n3ccc(=O)[nH]c3=O)[C@@H]3OC(C)(C)O[C@@H]32)c1 |
| InChI | InChI=1S/C18H23N5O6/c1-18(2)28-14-11(23-5-4-13(24)21-17(23)26)8-27-12(15(14)29-18)6-19-16(25)10-7-22(3)9-20-10/h4-5,7,9,11-12,14-15H,6,8H2,1-3H3,(H,19,25)(H,21,24,26)/t11-,12-,14+,15-/m1/s1 |
| InChIKey | RGDNWKGKTZRMGF-RJZRQDKASA-N |
| XLogP | -0.84 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |