C38H34FN5O5 — CID 133106856
cis-(3S,6R,9Z,12Z)-6-benzyl-9,12-dibenzylidene-3-[(4-fluorophenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone (PubChem CID 133106856) has the molecular formula C38H34FN5O5 and a molecular weight of 659.72 g/mol. Its IUPAC name is cis-(3S,6R,9Z,12Z)-6-benzyl-9,12-dibenzylidene-3-[(4-fluorophenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone.
| Compound Name | cis-(3S,6R,9Z,12Z)-6-benzyl-9,12-dibenzylidene-3-[(4-fluorophenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 133106856 |
| Molecular Formula | C38H34FN5O5 |
| Molecular Weight | 659.72 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | cis-(3S,6R,9Z,12Z)-6-benzyl-9,12-dibenzylidene-3-[(4-fluorophenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
| SMILES | O=C1CNC(=O)[C@H](Cc2ccc(F)cc2)NC(=O)[C@@H](Cc2ccccc2)NC(=O)/C(=C/c2ccccc2)NC(=O)/C(=C/c2ccccc2)N1 |
| InChI | InChI=1S/C38H34FN5O5/c39-29-18-16-28(17-19-29)23-30-35(46)40-24-34(45)41-31(20-25-10-4-1-5-11-25)36(47)43-33(22-27-14-8-3-9-15-27)38(49)44-32(37(48)42-30)21-26-12-6-2-7-13-26/h1-20,22,30,32H,21,23-24H2,(H,40,46)(H,41,45)(H,42,48)(H,43,47)(H,44,49)/b31-20-,33-22-/t30-,32+/m0/s1 |
| InChIKey | WYKLLTVTYXZNEJ-PGUCGDMJSA-N |
| XLogP | 3.02 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|